C16H21ClN6 — CID 139027065
2-[4-(6-tert-butylpyrimidin-4-yl)piperazin-1-yl]-5-chloropyrimidine (PubChem CID 139027065) has the molecular formula C16H21ClN6 and a molecular weight of 332.84 g/mol. Its IUPAC name is 2-[4-(6-tert-butylpyrimidin-4-yl)piperazin-1-yl]-5-chloropyrimidine.
| Compound Name | 2-[4-(6-tert-butylpyrimidin-4-yl)piperazin-1-yl]-5-chloropyrimidine |
|---|---|
| PubChem CID | 139027065 |
| Molecular Formula | C16H21ClN6 |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[4-(6-tert-butylpyrimidin-4-yl)piperazin-1-yl]-5-chloropyrimidine |
| SMILES | CC(C)(C)c1cc(N2CCN(c3ncc(Cl)cn3)CC2)ncn1 |
| InChI | InChI=1S/C16H21ClN6/c1-16(2,3)13-8-14(21-11-20-13)22-4-6-23(7-5-22)15-18-9-12(17)10-19-15/h8-11H,4-7H2,1-3H3 |
| InChIKey | KUHXMVVHQGNAMM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |