C17H28N4O2 — CID 126850013
tert-butyl 4-(6-tert-butylpyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 126850013) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is tert-butyl 4-(6-tert-butylpyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-tert-butylpyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 126850013 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | tert-butyl 4-(6-tert-butylpyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(C(C)(C)C)ncn2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-16(2,3)13-11-14(19-12-18-13)20-7-9-21(10-8-20)15(22)23-17(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | UFEIDXBCBMPAEK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |