C18H30N6O3 — CID 155962552
tert-butyl 4-[6-(butan-2-ylcarbamoylamino)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 155962552) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is tert-butyl 4-[6-(butan-2-ylcarbamoylamino)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(butan-2-ylcarbamoylamino)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155962552 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | tert-butyl 4-[6-(butan-2-ylcarbamoylamino)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCC(C)NC(=O)Nc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ncn1 |
| InChI | InChI=1S/C18H30N6O3/c1-6-13(2)21-16(25)22-14-11-15(20-12-19-14)23-7-9-24(10-8-23)17(26)27-18(3,4)5/h11-13H,6-10H2,1-5H3,(H2,19,20,21,22,25) |
| InChIKey | JVFHZQHKPJWOTK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |