C15H24N4O2 — CID 86690166
tert-butyl 4-(6-ethylpyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 86690166) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl 4-(6-ethylpyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-ethylpyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86690166 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | tert-butyl 4-(6-ethylpyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CCc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ncn1 |
| InChI | InChI=1S/C15H24N4O2/c1-5-12-10-13(17-11-16-12)18-6-8-19(9-7-18)14(20)21-15(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | WRHLOIGMMJYGJA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |