C17H14F3N3O2 — CID 143380599
3-cyclopropylimidazolidine-2,4-dione;2-(3,4,5-trifluorophenyl)pyridine (PubChem CID 143380599) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 3-cyclopropylimidazolidine-2,4-dione;2-(3,4,5-trifluorophenyl)pyridine.
| Compound Name | 3-cyclopropylimidazolidine-2,4-dione;2-(3,4,5-trifluorophenyl)pyridine |
|---|---|
| PubChem CID | 143380599 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-cyclopropylimidazolidine-2,4-dione;2-(3,4,5-trifluorophenyl)pyridine |
| SMILES | Fc1cc(-c2ccccn2)cc(F)c1F.O=C1CNC(=O)N1C1CC1 |
| InChI | InChI=1S/C11H6F3N.C6H8N2O2/c12-8-5-7(6-9(13)11(8)14)10-3-1-2-4-15-10;9-5-3-7-6(10)8(5)4-1-2-4/h1-6H;4H,1-3H2,(H,7,10) |
| InChIKey | FDHBGAKIIQZTAE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|