C8H11N3 — CID 175273370
6,6-dimethyl-5,7-dihydropyrrolo[3,2-d]pyrimidine (PubChem CID 175273370) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 6,6-dimethyl-5,7-dihydropyrrolo[3,2-d]pyrimidine.
| Compound Name | 6,6-dimethyl-5,7-dihydropyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 175273370 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 6,6-dimethyl-5,7-dihydropyrrolo[3,2-d]pyrimidine |
| SMILES | CC1(C)Cc2ncncc2N1 |
| InChI | InChI=1S/C8H11N3/c1-8(2)3-6-7(11-8)4-9-5-10-6/h4-5,11H,3H2,1-2H3 |
| InChIKey | KIIBZIWRGCHLNM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |