C11H16BNO2 — CID 145450564
(2,2,6-trimethyl-1,3-dihydroindol-4-yl)boronic acid (PubChem CID 145450564) has the molecular formula C11H16BNO2 and a molecular weight of 205.07 g/mol. Its IUPAC name is (2,2,6-trimethyl-1,3-dihydroindol-4-yl)boronic acid.
| Compound Name | (2,2,6-trimethyl-1,3-dihydroindol-4-yl)boronic acid |
|---|---|
| PubChem CID | 145450564 |
| Molecular Formula | C11H16BNO2 |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2,2,6-trimethyl-1,3-dihydroindol-4-yl)boronic acid |
| SMILES | Cc1cc2c(c(B(O)O)c1)CC(C)(C)N2 |
| InChI | InChI=1S/C11H16BNO2/c1-7-4-9(12(14)15)8-6-11(2,3)13-10(8)5-7/h4-5,13-15H,6H2,1-3H3 |
| InChIKey | MKNKFXSONNULSQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|