C11H15BO3 — CID 139964809
(3,5-dimethyl-2-prop-2-enoxyphenyl)boronic acid (PubChem CID 139964809) has the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. Its IUPAC name is (3,5-dimethyl-2-prop-2-enoxyphenyl)boronic acid.
| Compound Name | (3,5-dimethyl-2-prop-2-enoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 139964809 |
| Molecular Formula | C11H15BO3 |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3,5-dimethyl-2-prop-2-enoxyphenyl)boronic acid |
| SMILES | C=CCOc1c(C)cc(C)cc1B(O)O |
| InChI | InChI=1S/C11H15BO3/c1-4-5-15-11-9(3)6-8(2)7-10(11)12(13)14/h4,6-7,13-14H,1,5H2,2-3H3 |
| InChIKey | ASVWXFXNFGUXHX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|