C33H38O3 — CID 171421209
5-[1,1-bis(3-methyl-4-prop-2-enoxyphenyl)ethyl]-1,3-dimethyl-2-prop-2-enoxybenzene (PubChem CID 171421209) has the molecular formula C33H38O3 and a molecular weight of 482.66 g/mol. Its IUPAC name is 5-[1,1-bis(3-methyl-4-prop-2-enoxyphenyl)ethyl]-1,3-dimethyl-2-prop-2-enoxybenzene.
| Compound Name | 5-[1,1-bis(3-methyl-4-prop-2-enoxyphenyl)ethyl]-1,3-dimethyl-2-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 171421209 |
| Molecular Formula | C33H38O3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 5-[1,1-bis(3-methyl-4-prop-2-enoxyphenyl)ethyl]-1,3-dimethyl-2-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(C(C)(c2ccc(OCC=C)c(C)c2)c2cc(C)c(OCC=C)c(C)c2)cc1C |
| InChI | InChI=1S/C33H38O3/c1-9-16-34-30-14-12-27(19-23(30)4)33(8,28-13-15-31(24(5)20-28)35-17-10-2)29-21-25(6)32(26(7)22-29)36-18-11-3/h9-15,19-22H,1-3,16-18H2,4-8H3 |
| InChIKey | IWQPMAUWDLHFBO-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|