About 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene
4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene (PubChem CID 89043876) has the molecular formula C23H24O6
and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene.
Molecular Properties
| Compound Name | 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene |
| PubChem CID | 89043876 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene |
| SMILES | Cc1cc(C(C)(c2ccc(OO)c(C)c2)c2ccc(OO)c(C)c2)ccc1OO |
| InChI | InChI=1S/C23H24O6/c1-14-11-17(5-8-20(14)27-24)23(4,18-6-9-21(28-25)15(2)12-18)19-7-10-22(29-26)16(3)13-19/h5-13,24-26H,1-4H3 |
| InChIKey | IONRCXGCOISVHF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene?
The IUPAC name of 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene (CID 89043876) is 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene.
What is the SMILES notation for 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene?
The canonical SMILES for 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene is Cc1cc(C(C)(c2ccc(OO)c(C)c2)c2ccc(OO)c(C)c2)ccc1OO.
What is the InChIKey of 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene?
The InChIKey is IONRCXGCOISVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O6/c1-14-11-17(5-8-20(14)27-24)23(4,18-6-9-21(28-25)15(2)12-18)19-7-10-22(29-26)16(3)13-19/h5-13,24-26H,1-4H3.
What are the key properties of 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene?
4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene has a molecular weight of 396.44 g/mol, XLogP of 5.52, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,1-bis(4-hydroperoxy-3-methylphenyl)ethyl]-1-hydroperoxy-2-methylbenzene is sourced from PubChem (CID 89043876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).