C17H15BrF2O — CID 139964874
1-bromo-2-(3,5-dimethyl-2-prop-2-enoxyphenyl)-4,5-difluorobenzene (PubChem CID 139964874) has the molecular formula C17H15BrF2O and a molecular weight of 353.21 g/mol. Its IUPAC name is 1-bromo-2-(3,5-dimethyl-2-prop-2-enoxyphenyl)-4,5-difluorobenzene.
| Compound Name | 1-bromo-2-(3,5-dimethyl-2-prop-2-enoxyphenyl)-4,5-difluorobenzene |
|---|---|
| PubChem CID | 139964874 |
| Molecular Formula | C17H15BrF2O |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-bromo-2-(3,5-dimethyl-2-prop-2-enoxyphenyl)-4,5-difluorobenzene |
| SMILES | C=CCOc1c(C)cc(C)cc1-c1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C17H15BrF2O/c1-4-5-21-17-11(3)6-10(2)7-13(17)12-8-15(19)16(20)9-14(12)18/h4,6-9H,1,5H2,2-3H3 |
| InChIKey | CECGHQCZJQLSAJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|