C21H15BrF2O — CID 139964980
1-bromo-4,5-difluoro-2-(3-phenyl-2-prop-2-enoxyphenyl)benzene (PubChem CID 139964980) has the molecular formula C21H15BrF2O and a molecular weight of 401.25 g/mol. Its IUPAC name is 1-bromo-4,5-difluoro-2-(3-phenyl-2-prop-2-enoxyphenyl)benzene.
| Compound Name | 1-bromo-4,5-difluoro-2-(3-phenyl-2-prop-2-enoxyphenyl)benzene |
|---|---|
| PubChem CID | 139964980 |
| Molecular Formula | C21H15BrF2O |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1-bromo-4,5-difluoro-2-(3-phenyl-2-prop-2-enoxyphenyl)benzene |
| SMILES | C=CCOc1c(-c2ccccc2)cccc1-c1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C21H15BrF2O/c1-2-11-25-21-15(14-7-4-3-5-8-14)9-6-10-16(21)17-12-19(23)20(24)13-18(17)22/h2-10,12-13H,1,11H2 |
| InChIKey | HFMFZUJJVPVELS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|