C21H19NO — CID 141482512
3-methyl-4,6-diphenyl-2-prop-2-enoxypyridine (PubChem CID 141482512) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-methyl-4,6-diphenyl-2-prop-2-enoxypyridine.
| Compound Name | 3-methyl-4,6-diphenyl-2-prop-2-enoxypyridine |
|---|---|
| PubChem CID | 141482512 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-methyl-4,6-diphenyl-2-prop-2-enoxypyridine |
| SMILES | C=CCOc1nc(-c2ccccc2)cc(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H19NO/c1-3-14-23-21-16(2)19(17-10-6-4-7-11-17)15-20(22-21)18-12-8-5-9-13-18/h3-13,15H,1,14H2,2H3 |
| InChIKey | UWMNMOHWZAWGAY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|