C21H19NO2 — CID 171904871
6-(4-methylphenyl)-4-phenyl-5-prop-2-enoxy-1H-pyridin-2-one (PubChem CID 171904871) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-(4-methylphenyl)-4-phenyl-5-prop-2-enoxy-1H-pyridin-2-one.
| Compound Name | 6-(4-methylphenyl)-4-phenyl-5-prop-2-enoxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171904871 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-(4-methylphenyl)-4-phenyl-5-prop-2-enoxy-1H-pyridin-2-one |
| SMILES | C=CCOc1c(-c2ccccc2)cc(=O)[nH]c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C21H19NO2/c1-3-13-24-21-18(16-7-5-4-6-8-16)14-19(23)22-20(21)17-11-9-15(2)10-12-17/h3-12,14H,1,13H2,2H3,(H,22,23) |
| InChIKey | YPLCVYDYOPBAAR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|