C29H28N2O — CID 139705769
1-N,2-N-bis(4-methylphenyl)-4-phenyl-3-prop-2-enoxybenzene-1,2-diamine (PubChem CID 139705769) has the molecular formula C29H28N2O and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-N,2-N-bis(4-methylphenyl)-4-phenyl-3-prop-2-enoxybenzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis(4-methylphenyl)-4-phenyl-3-prop-2-enoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 139705769 |
| Molecular Formula | C29H28N2O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-N,2-N-bis(4-methylphenyl)-4-phenyl-3-prop-2-enoxybenzene-1,2-diamine |
| SMILES | C=CCOc1c(-c2ccccc2)ccc(Nc2ccc(C)cc2)c1Nc1ccc(C)cc1 |
| InChI | InChI=1S/C29H28N2O/c1-4-20-32-29-26(23-8-6-5-7-9-23)18-19-27(30-24-14-10-21(2)11-15-24)28(29)31-25-16-12-22(3)13-17-25/h4-19,30-31H,1,20H2,2-3H3 |
| InChIKey | OSUBXVLCAYQPCE-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|