C23H26OSi — CID 139964888
cyclopenta-1,3-dien-1-yl-dimethyl-[(3-phenyl-2-prop-2-enoxyphenyl)methyl]silane (PubChem CID 139964888) has the molecular formula C23H26OSi and a molecular weight of 346.55 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl-dimethyl-[(3-phenyl-2-prop-2-enoxyphenyl)methyl]silane.
| Compound Name | cyclopenta-1,3-dien-1-yl-dimethyl-[(3-phenyl-2-prop-2-enoxyphenyl)methyl]silane |
|---|---|
| PubChem CID | 139964888 |
| Molecular Formula | C23H26OSi |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl-dimethyl-[(3-phenyl-2-prop-2-enoxyphenyl)methyl]silane |
| SMILES | C=CCOc1c(C[Si](C)(C)C2=CC=CC2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C23H26OSi/c1-4-17-24-23-20(18-25(2,3)21-14-8-9-15-21)13-10-16-22(23)19-11-6-5-7-12-19/h4-14,16H,1,15,17-18H2,2-3H3 |
| InChIKey | MYOKKXMQRGMQHN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|