C18H18O — CID 155642904
4-phenyl-1-prop-2-enoxy-2-prop-2-enylbenzene (PubChem CID 155642904) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-phenyl-1-prop-2-enoxy-2-prop-2-enylbenzene.
| Compound Name | 4-phenyl-1-prop-2-enoxy-2-prop-2-enylbenzene |
|---|---|
| PubChem CID | 155642904 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-phenyl-1-prop-2-enoxy-2-prop-2-enylbenzene |
| SMILES | C=CCOc1ccc(-c2ccccc2)cc1CC=C |
| InChI | InChI=1S/C18H18O/c1-3-8-17-14-16(15-9-6-5-7-10-15)11-12-18(17)19-13-4-2/h3-7,9-12,14H,1-2,8,13H2 |
| InChIKey | FTWVVHCDAZTKLV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|