C15H18O — CID 66892127
2-prop-2-enoxy-1,4-bis(prop-2-enyl)benzene (PubChem CID 66892127) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-prop-2-enoxy-1,4-bis(prop-2-enyl)benzene.
| Compound Name | 2-prop-2-enoxy-1,4-bis(prop-2-enyl)benzene |
|---|---|
| PubChem CID | 66892127 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-prop-2-enoxy-1,4-bis(prop-2-enyl)benzene |
| SMILES | C=CCOc1cc(CC=C)ccc1CC=C |
| InChI | InChI=1S/C15H18O/c1-4-7-13-9-10-14(8-5-2)15(12-13)16-11-6-3/h4-6,9-10,12H,1-3,7-8,11H2 |
| InChIKey | ATAAQSKGQGVGKK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|