C24H31BrO — CID 177315432
1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-prop-2-enoxybenzene (PubChem CID 177315432) has the molecular formula C24H31BrO and a molecular weight of 415.42 g/mol. Its IUPAC name is 1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-prop-2-enoxybenzene.
| Compound Name | 1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 177315432 |
| Molecular Formula | C24H31BrO |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-prop-2-enoxybenzene |
| SMILES | C=CCOc1c(Br)cc(C)cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H31BrO/c1-9-10-26-22-20(11-16(2)12-21(22)25)17-13-18(23(3,4)5)15-19(14-17)24(6,7)8/h9,11-15H,1,10H2,2-8H3 |
| InChIKey | DCHMMBOXOILUSN-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|