C21H27BrO — CID 177315447
2-bromo-6-(3,5-ditert-butylphenyl)-4-methylphenol (PubChem CID 177315447) has the molecular formula C21H27BrO and a molecular weight of 375.35 g/mol. Its IUPAC name is 2-bromo-6-(3,5-ditert-butylphenyl)-4-methylphenol.
| Compound Name | 2-bromo-6-(3,5-ditert-butylphenyl)-4-methylphenol |
|---|---|
| PubChem CID | 177315447 |
| Molecular Formula | C21H27BrO |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-bromo-6-(3,5-ditert-butylphenyl)-4-methylphenol |
| SMILES | Cc1cc(Br)c(O)c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H27BrO/c1-13-8-17(19(23)18(22)9-13)14-10-15(20(2,3)4)12-16(11-14)21(5,6)7/h8-12,23H,1-7H3 |
| InChIKey | LEVDSNNRNXQYKE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |