C19H24O4 — CID 132548292
2-tert-butyl-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylphenol (PubChem CID 132548292) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-tert-butyl-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylphenol.
| Compound Name | 2-tert-butyl-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylphenol |
|---|---|
| PubChem CID | 132548292 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-tert-butyl-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-methylphenol |
| SMILES | COc1cc(-c2cc(C)cc(C(C)(C)C)c2O)cc(OC)c1O |
| InChI | InChI=1S/C19H24O4/c1-11-7-13(17(20)14(8-11)19(2,3)4)12-9-15(22-5)18(21)16(10-12)23-6/h7-10,20-21H,1-6H3 |
| InChIKey | XLRDGFDXQDLKOO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |