C21H29NO3 — CID 151665539
2-tert-butyl-6-[2-(ethylamino)-4,5-dimethoxyphenyl]-4-methylphenol (PubChem CID 151665539) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-tert-butyl-6-[2-(ethylamino)-4,5-dimethoxyphenyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[2-(ethylamino)-4,5-dimethoxyphenyl]-4-methylphenol |
|---|---|
| PubChem CID | 151665539 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-tert-butyl-6-[2-(ethylamino)-4,5-dimethoxyphenyl]-4-methylphenol |
| SMILES | CCNc1cc(OC)c(OC)cc1-c1cc(C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H29NO3/c1-8-22-17-12-19(25-7)18(24-6)11-14(17)15-9-13(2)10-16(20(15)23)21(3,4)5/h9-12,22-23H,8H2,1-7H3 |
| InChIKey | QXLHNKFMLIJSIR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|