C28H33BrO — CID 20749767
1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-phenylmethoxybenzene (PubChem CID 20749767) has the molecular formula C28H33BrO and a molecular weight of 465.48 g/mol. Its IUPAC name is 1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-phenylmethoxybenzene.
| Compound Name | 1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 20749767 |
| Molecular Formula | C28H33BrO |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1-bromo-3-(3,5-ditert-butylphenyl)-5-methyl-2-phenylmethoxybenzene |
| SMILES | Cc1cc(Br)c(OCc2ccccc2)c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C28H33BrO/c1-19-13-24(26(25(29)14-19)30-18-20-11-9-8-10-12-20)21-15-22(27(2,3)4)17-23(16-21)28(5,6)7/h8-17H,18H2,1-7H3 |
| InChIKey | UBOBXNZLJXAYQT-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |