C15H14Br2O2 — CID 23386525
2-bromo-6-[(3-bromo-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol (PubChem CID 23386525) has the molecular formula C15H14Br2O2 and a molecular weight of 386.08 g/mol. Its IUPAC name is 2-bromo-6-[(3-bromo-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol.
| Compound Name | 2-bromo-6-[(3-bromo-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 23386525 |
| Molecular Formula | C15H14Br2O2 |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 2-bromo-6-[(3-bromo-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
| SMILES | Cc1cc(Br)c(O)c(Cc2cc(C)cc(Br)c2O)c1 |
| InChI | InChI=1S/C15H14Br2O2/c1-8-3-10(14(18)12(16)5-8)7-11-4-9(2)6-13(17)15(11)19/h3-6,18-19H,7H2,1-2H3 |
| InChIKey | AFDOZAAFJVLBTI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |