C20H24N2 — CID 139257919
2,2-dimethyl-N-(2,4,6-trimethylphenyl)-1,3-dihydroquinolin-4-imine (PubChem CID 139257919) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2,4,6-trimethylphenyl)-1,3-dihydroquinolin-4-imine.
| Compound Name | 2,2-dimethyl-N-(2,4,6-trimethylphenyl)-1,3-dihydroquinolin-4-imine |
|---|---|
| PubChem CID | 139257919 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2,2-dimethyl-N-(2,4,6-trimethylphenyl)-1,3-dihydroquinolin-4-imine |
| SMILES | Cc1cc(C)c(/N=C2\CC(C)(C)Nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C20H24N2/c1-13-10-14(2)19(15(3)11-13)21-18-12-20(4,5)22-17-9-7-6-8-16(17)18/h6-11,22H,12H2,1-5H3/b21-18+ |
| InChIKey | BETMDSUMTWYKRE-DYTRJAOYSA-N |
| XLogP | 5.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|