C19H22N2 — CID 136869903
N-(3,4-dimethylphenyl)-2,2-dimethyl-1,3-dihydroquinolin-4-imine (PubChem CID 136869903) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,2-dimethyl-1,3-dihydroquinolin-4-imine.
| Compound Name | N-(3,4-dimethylphenyl)-2,2-dimethyl-1,3-dihydroquinolin-4-imine |
|---|---|
| PubChem CID | 136869903 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,2-dimethyl-1,3-dihydroquinolin-4-imine |
| SMILES | Cc1ccc(/N=C2\CC(C)(C)Nc3ccccc32)cc1C |
| InChI | InChI=1S/C19H22N2/c1-13-9-10-15(11-14(13)2)20-18-12-19(3,4)21-17-8-6-5-7-16(17)18/h5-11,21H,12H2,1-4H3/b20-18+ |
| InChIKey | ULKFBYYKEOMKOV-CZIZESTLSA-N |
| XLogP | 5.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|