C11H18N2 — CID 91109897
(3,4-dimethylphenyl)-methyldiazene;ethane (PubChem CID 91109897) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-methyldiazene;ethane.
| Compound Name | (3,4-dimethylphenyl)-methyldiazene;ethane |
|---|---|
| PubChem CID | 91109897 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3,4-dimethylphenyl)-methyldiazene;ethane |
| SMILES | C/N=N/c1ccc(C)c(C)c1.CC |
| InChI | InChI=1S/C9H12N2.C2H6/c1-7-4-5-9(11-10-3)6-8(7)2;1-2/h4-6H,1-3H3;1-2H3/b11-10+; |
| InChIKey | KQPLOAMVHJHOFL-ASTDGNLGSA-N |
| XLogP | 4.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|