C17H20N4S — CID 102195286
1-(3,4-dimethylanilino)-3-(3,4-dimethylphenyl)iminothiourea (PubChem CID 102195286) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(3,4-dimethylanilino)-3-(3,4-dimethylphenyl)iminothiourea.
| Compound Name | 1-(3,4-dimethylanilino)-3-(3,4-dimethylphenyl)iminothiourea |
|---|---|
| PubChem CID | 102195286 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(3,4-dimethylanilino)-3-(3,4-dimethylphenyl)iminothiourea |
| SMILES | Cc1ccc(/N=N/C(=S)NNc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C17H20N4S/c1-11-5-7-15(9-13(11)3)18-20-17(22)21-19-16-8-6-12(2)14(4)10-16/h5-10,18H,1-4H3,(H,20,22)/b21-19+ |
| InChIKey | GYLIELROQUMXHE-XUTLUUPISA-N |
| XLogP | 4.91 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|