C9H12N2O — CID 136994157
2,6-dimethyl-4-(methyldiazenyl)phenol (PubChem CID 136994157) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2,6-dimethyl-4-(methyldiazenyl)phenol.
| Compound Name | 2,6-dimethyl-4-(methyldiazenyl)phenol |
|---|---|
| PubChem CID | 136994157 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2,6-dimethyl-4-(methyldiazenyl)phenol |
| SMILES | C/N=N/c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C9H12N2O/c1-6-4-8(11-10-3)5-7(2)9(6)12/h4-5,12H,1-3H3/b11-10+ |
| InChIKey | JCHXVTWFDPRDDI-ZHACJKMWSA-N |
| XLogP | 2.72 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|