C16H19O2P — CID 146303412
4-(4-hydroxy-3,5-dimethylphenyl)phosphanyl-2,6-dimethylphenol (PubChem CID 146303412) has the molecular formula C16H19O2P and a molecular weight of 274.30 g/mol. Its IUPAC name is 4-(4-hydroxy-3,5-dimethylphenyl)phosphanyl-2,6-dimethylphenol.
| Compound Name | 4-(4-hydroxy-3,5-dimethylphenyl)phosphanyl-2,6-dimethylphenol |
|---|---|
| PubChem CID | 146303412 |
| Molecular Formula | C16H19O2P |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-(4-hydroxy-3,5-dimethylphenyl)phosphanyl-2,6-dimethylphenol |
| SMILES | Cc1cc(Pc2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C16H19O2P/c1-9-5-13(6-10(2)15(9)17)19-14-7-11(3)16(18)12(4)8-14/h5-8,17-19H,1-4H3 |
| InChIKey | ILTJWANYICAKLM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|