C9H12IO- — CID 146709623
2,6-dimethyl-4-methyliodanuidylphenol (PubChem CID 146709623) has the molecular formula C9H12IO- and a molecular weight of 263.10 g/mol. Its IUPAC name is 2,6-dimethyl-4-methyliodanuidylphenol.
| Compound Name | 2,6-dimethyl-4-methyliodanuidylphenol |
|---|---|
| PubChem CID | 146709623 |
| Molecular Formula | C9H12IO- |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 2,6-dimethyl-4-methyliodanuidylphenol |
| SMILES | C[I-]c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C9H12IO/c1-6-4-8(10-3)5-7(2)9(6)11/h4-5,11H,1-3H3/q-1 |
| InChIKey | ILTOYKSWJOQLCS-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|