C16H18O2Se2 — CID 59843656
4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol (PubChem CID 59843656) has the molecular formula C16H18O2Se2 and a molecular weight of 400.24 g/mol. Its IUPAC name is 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol.
| Compound Name | 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 59843656 |
| Molecular Formula | C16H18O2Se2 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol |
| SMILES | Cc1cc([Se][Se]c2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C16H18O2Se2/c1-9-5-13(6-10(2)15(9)17)19-20-14-7-11(3)16(18)12(4)8-14/h5-8,17-18H,1-4H3 |
| InChIKey | YHDGKIGRCWWQOI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|