About 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol
4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol (PubChem CID 59843656) has the molecular formula C16H18O2Se2
and a molecular weight of 400.24 g/mol. Its IUPAC name is 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol |
| PubChem CID | 59843656 |
| Molecular Formula | C16H18O2Se2 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol |
| SMILES | Cc1cc([Se][Se]c2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C16H18O2Se2/c1-9-5-13(6-10(2)15(9)17)19-20-14-7-11(3)16(18)12(4)8-14/h5-8,17-18H,1-4H3 |
| InChIKey | YHDGKIGRCWWQOI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol?
The IUPAC name of 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol (CID 59843656) is 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol is Cc1cc([Se][Se]c2cc(C)c(O)c(C)c2)cc(C)c1O.
What is the InChIKey of 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol?
The InChIKey is YHDGKIGRCWWQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2Se2/c1-9-5-13(6-10(2)15(9)17)19-20-14-7-11(3)16(18)12(4)8-14/h5-8,17-18H,1-4H3.
What are the key properties of 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol?
4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol has a molecular weight of 400.24 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-hydroxy-3,5-dimethylphenyl)diselanyl]-2,6-dimethylphenol is sourced from PubChem (CID 59843656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).