C16H20N2O2 — CID 151482165
4-[2-(4-hydroxy-3,5-dimethylphenyl)hydrazinyl]-2,6-dimethylphenol (PubChem CID 151482165) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[2-(4-hydroxy-3,5-dimethylphenyl)hydrazinyl]-2,6-dimethylphenol.
| Compound Name | 4-[2-(4-hydroxy-3,5-dimethylphenyl)hydrazinyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 151482165 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-[2-(4-hydroxy-3,5-dimethylphenyl)hydrazinyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(NNc2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C16H20N2O2/c1-9-5-13(6-10(2)15(9)19)17-18-14-7-11(3)16(20)12(4)8-14/h5-8,17-20H,1-4H3 |
| InChIKey | PMRZAWBWCKTXOB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|