C14H16N2O — CID 135597296
3,6,7-trimethyl-2-(methyldiazenyl)naphthalen-1-ol (PubChem CID 135597296) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 3,6,7-trimethyl-2-(methyldiazenyl)naphthalen-1-ol.
| Compound Name | 3,6,7-trimethyl-2-(methyldiazenyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 135597296 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3,6,7-trimethyl-2-(methyldiazenyl)naphthalen-1-ol |
| SMILES | C/N=N/c1c(C)cc2cc(C)c(C)cc2c1O |
| InChI | InChI=1S/C14H16N2O/c1-8-5-11-6-10(3)13(16-15-4)14(17)12(11)7-9(8)2/h5-7,17H,1-4H3/b16-15+ |
| InChIKey | DSBJMIMBOGFEPI-FOCLMDBBSA-N |
| XLogP | 4.18 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|