C25H29N5O — CID 135997793
6-[ethyl(methyl)amino]-3-methyl-2-[[4-(methyldiazenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]diazenyl]naphthalen-1-ol (PubChem CID 135997793) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 6-[ethyl(methyl)amino]-3-methyl-2-[[4-(methyldiazenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]diazenyl]naphthalen-1-ol.
| Compound Name | 6-[ethyl(methyl)amino]-3-methyl-2-[[4-(methyldiazenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 135997793 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 6-[ethyl(methyl)amino]-3-methyl-2-[[4-(methyldiazenyl)-5,6,7,8-tetrahydronaphthalen-1-yl]diazenyl]naphthalen-1-ol |
| SMILES | CCN(C)c1ccc2c(O)c(/N=N/c3ccc(/N=N/C)c4c3CCCC4)c(C)cc2c1 |
| InChI | InChI=1S/C25H29N5O/c1-5-30(4)18-10-11-19-17(15-18)14-16(2)24(25(19)31)29-28-23-13-12-22(27-26-3)20-8-6-7-9-21(20)23/h10-15,31H,5-9H2,1-4H3/b27-26+,29-28+ |
| InChIKey | KMEKOOOWALURMF-ZDXBJJIESA-N |
| XLogP | 7.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|