C20H21N3O4S — CID 135626972
4-[(dimethylamino)methyl]-2-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]benzenesulfonic acid (PubChem CID 135626972) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-2-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(dimethylamino)methyl]-2-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135626972 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-[(dimethylamino)methyl]-2-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc2ccccc2c(O)c1/N=N/c1cc(CN(C)C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C20H21N3O4S/c1-13-10-15-6-4-5-7-16(15)20(24)19(13)22-21-17-11-14(12-23(2)3)8-9-18(17)28(25,26)27/h4-11,24H,12H2,1-3H3,(H,25,26,27)/b22-21+ |
| InChIKey | DUKFUQANMPBZJZ-QURGRASLSA-N |
| XLogP | 4.58 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|