C22H19N3O7S2 — CID 135626995
3-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-7-(methylamino)naphthalene-1,5-disulfonic acid (PubChem CID 135626995) has the molecular formula C22H19N3O7S2 and a molecular weight of 501.54 g/mol. Its IUPAC name is 3-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-7-(methylamino)naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-7-(methylamino)naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 135626995 |
| Molecular Formula | C22H19N3O7S2 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 3-[(1-hydroxy-3-methylnaphthalen-2-yl)diazenyl]-7-(methylamino)naphthalene-1,5-disulfonic acid |
| SMILES | CNc1cc(S(=O)(=O)O)c2cc(/N=N/c3c(C)cc4ccccc4c3O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C22H19N3O7S2/c1-12-7-13-5-3-4-6-16(13)22(26)21(12)25-24-15-9-18-17(20(11-15)34(30,31)32)8-14(23-2)10-19(18)33(27,28)29/h3-11,23,26H,1-2H3,(H,27,28,29)(H,30,31,32)/b25-24+ |
| InChIKey | VJNBQQQRNKNGJG-OCOZRVBESA-N |
| XLogP | 4.96 |
| TPSA | 165.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|