C19H27N4+ — CID 122626333
4-[(1-butylpyridin-1-ium-3-yl)diazenyl]-N-ethyl-N,3-dimethylaniline (PubChem CID 122626333) has the molecular formula C19H27N4+ and a molecular weight of 311.45 g/mol. Its IUPAC name is 4-[(1-butylpyridin-1-ium-3-yl)diazenyl]-N-ethyl-N,3-dimethylaniline.
| Compound Name | 4-[(1-butylpyridin-1-ium-3-yl)diazenyl]-N-ethyl-N,3-dimethylaniline |
|---|---|
| PubChem CID | 122626333 |
| Molecular Formula | C19H27N4+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 4-[(1-butylpyridin-1-ium-3-yl)diazenyl]-N-ethyl-N,3-dimethylaniline |
| SMILES | CCCC[n+]1cccc(/N=N/c2ccc(N(C)CC)cc2C)c1 |
| InChI | InChI=1S/C19H27N4/c1-5-7-12-23-13-8-9-17(15-23)20-21-19-11-10-18(14-16(19)3)22(4)6-2/h8-11,13-15H,5-7,12H2,1-4H3/q+1/b21-20+ |
| InChIKey | RHYJXEHRCYTJRW-QZQOTICOSA-N |
| XLogP | 4.95 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|