C27H29N5 — CID 88577819
4-[[4-[(4-butylphenyl)diazenyl]phenyl]diazenyl]-N-ethyl-N-ethynyl-3-methylaniline (PubChem CID 88577819) has the molecular formula C27H29N5 and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-[[4-[(4-butylphenyl)diazenyl]phenyl]diazenyl]-N-ethyl-N-ethynyl-3-methylaniline.
| Compound Name | 4-[[4-[(4-butylphenyl)diazenyl]phenyl]diazenyl]-N-ethyl-N-ethynyl-3-methylaniline |
|---|---|
| PubChem CID | 88577819 |
| Molecular Formula | C27H29N5 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-[[4-[(4-butylphenyl)diazenyl]phenyl]diazenyl]-N-ethyl-N-ethynyl-3-methylaniline |
| SMILES | C#CN(CC)c1ccc(/N=N/c2ccc(/N=N/c3ccc(CCCC)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C27H29N5/c1-5-8-9-22-10-12-23(13-11-22)28-29-24-14-16-25(17-15-24)30-31-27-19-18-26(20-21(27)4)32(6-2)7-3/h2,10-20H,5,7-9H2,1,3-4H3/b29-28+,31-30+ |
| InChIKey | GMDPJVGDDAEZQL-DUJDKOHPSA-N |
| XLogP | 8.59 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|