C36H42N6 — CID 100995300
bis[4-[(4-butylphenyl)diazenyl]-3,5-dimethylphenyl]diazene (PubChem CID 100995300) has the molecular formula C36H42N6 and a molecular weight of 558.77 g/mol. Its IUPAC name is bis[4-[(4-butylphenyl)diazenyl]-3,5-dimethylphenyl]diazene.
| Compound Name | bis[4-[(4-butylphenyl)diazenyl]-3,5-dimethylphenyl]diazene |
|---|---|
| PubChem CID | 100995300 |
| Molecular Formula | C36H42N6 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | bis[4-[(4-butylphenyl)diazenyl]-3,5-dimethylphenyl]diazene |
| SMILES | CCCCc1ccc(/N=N/c2c(C)cc(/N=N/c3cc(C)c(/N=N/c4ccc(CCCC)cc4)c(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C36H42N6/c1-7-9-11-29-13-17-31(18-14-29)37-41-35-25(3)21-33(22-26(35)4)39-40-34-23-27(5)36(28(6)24-34)42-38-32-19-15-30(16-20-32)12-10-8-2/h13-24H,7-12H2,1-6H3/b40-39+,41-37+,42-38+ |
| InChIKey | AWIUZPPJOBASQL-FEQQBOOHSA-N |
| XLogP | 12.85 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|