C22H26N6O — CID 135976122
4-[[4-[(4-butylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2,5-dimethyl-1H-pyrazol-3-one (PubChem CID 135976122) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-[[4-[(4-butylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2,5-dimethyl-1H-pyrazol-3-one.
| Compound Name | 4-[[4-[(4-butylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2,5-dimethyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135976122 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-[[4-[(4-butylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2,5-dimethyl-1H-pyrazol-3-one |
| SMILES | CCCCc1ccc(/N=N/c2ccc(/N=N/c3c(C)[nH]n(C)c3=O)c(C)c2)cc1 |
| InChI | InChI=1S/C22H26N6O/c1-5-6-7-17-8-10-18(11-9-17)23-24-19-12-13-20(15(2)14-19)25-26-21-16(3)27-28(4)22(21)29/h8-14,27H,5-7H2,1-4H3/b24-23+,26-25+ |
| InChIKey | WAVKCVGJVYSXMW-QSZPNPOGSA-N |
| XLogP | 6.50 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|