C24H29N7 — CID 126491935
4-[[2-[(4-butylphenyl)diazenyl]pyrimidin-5-yl]diazenyl]-N,N-diethylaniline (PubChem CID 126491935) has the molecular formula C24H29N7 and a molecular weight of 415.55 g/mol. Its IUPAC name is 4-[[2-[(4-butylphenyl)diazenyl]pyrimidin-5-yl]diazenyl]-N,N-diethylaniline.
| Compound Name | 4-[[2-[(4-butylphenyl)diazenyl]pyrimidin-5-yl]diazenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 126491935 |
| Molecular Formula | C24H29N7 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 4-[[2-[(4-butylphenyl)diazenyl]pyrimidin-5-yl]diazenyl]-N,N-diethylaniline |
| SMILES | CCCCc1ccc(/N=N/c2ncc(/N=N/c3ccc(N(CC)CC)cc3)cn2)cc1 |
| InChI | InChI=1S/C24H29N7/c1-4-7-8-19-9-11-20(12-10-19)28-30-24-25-17-22(18-26-24)29-27-21-13-15-23(16-14-21)31(5-2)6-3/h9-18H,4-8H2,1-3H3/b29-27+,30-28+ |
| InChIKey | MWVCOZXRBJNEHC-QAVVBOBSSA-N |
| XLogP | 7.50 |
| TPSA | 78.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|