C40H44O3 — CID 158189800
2,3,6,7-tetramethylnaphthalen-1-ol;2,3,6-trimethylnaphthalen-1-ol;2,3,7-trimethylnaphthalen-1-ol (PubChem CID 158189800) has the molecular formula C40H44O3 and a molecular weight of 572.79 g/mol. Its IUPAC name is 2,3,6,7-tetramethylnaphthalen-1-ol;2,3,6-trimethylnaphthalen-1-ol;2,3,7-trimethylnaphthalen-1-ol.
| Compound Name | 2,3,6,7-tetramethylnaphthalen-1-ol;2,3,6-trimethylnaphthalen-1-ol;2,3,7-trimethylnaphthalen-1-ol |
|---|---|
| PubChem CID | 158189800 |
| Molecular Formula | C40H44O3 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 2,3,6,7-tetramethylnaphthalen-1-ol;2,3,6-trimethylnaphthalen-1-ol;2,3,7-trimethylnaphthalen-1-ol |
| SMILES | Cc1cc2cc(C)c(C)c(O)c2cc1C.Cc1ccc2c(O)c(C)c(C)cc2c1.Cc1ccc2cc(C)c(C)c(O)c2c1 |
| InChI | InChI=1S/C14H16O.2C13H14O/c1-8-5-12-6-10(3)11(4)14(15)13(12)7-9(8)2;1-8-4-5-12-11(6-8)7-9(2)10(3)13(12)14;1-8-4-5-11-7-9(2)10(3)13(14)12(11)6-8/h5-7,15H,1-4H3;2*4-7,14H,1-3H3 |
| InChIKey | FZPJKJDNFFUTHC-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |