C24H22O3 — CID 159879236
2,6-dimethylnaphthalen-1-ol;1-hydroxy-6-methylnaphthalene-2-carbaldehyde (PubChem CID 159879236) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2,6-dimethylnaphthalen-1-ol;1-hydroxy-6-methylnaphthalene-2-carbaldehyde.
| Compound Name | 2,6-dimethylnaphthalen-1-ol;1-hydroxy-6-methylnaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 159879236 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2,6-dimethylnaphthalen-1-ol;1-hydroxy-6-methylnaphthalene-2-carbaldehyde |
| SMILES | Cc1ccc2c(O)c(C)ccc2c1.Cc1ccc2c(O)c(C=O)ccc2c1 |
| InChI | InChI=1S/C12H10O2.C12H12O/c1-8-2-5-11-9(6-8)3-4-10(7-13)12(11)14;1-8-3-6-11-10(7-8)5-4-9(2)12(11)13/h2-7,14H,1H3;3-7,13H,1-2H3 |
| InChIKey | NTHVIJDSLUFQEV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|