C14H15N3O4S — CID 135962600
6,7-dimethyl-2-[(methylideneamino)methyldiazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol (PubChem CID 135962600) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 6,7-dimethyl-2-[(methylideneamino)methyldiazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol.
| Compound Name | 6,7-dimethyl-2-[(methylideneamino)methyldiazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 135962600 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 6,7-dimethyl-2-[(methylideneamino)methyldiazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol |
| SMILES | C=NC/N=N/c1c(SOOO)cc2cc(C)c(C)cc2c1O |
| InChI | InChI=1S/C14H15N3O4S/c1-8-4-10-6-12(22-21-20-19)13(17-16-7-15-3)14(18)11(10)5-9(8)2/h4-6,18-19H,3,7H2,1-2H3/b17-16+ |
| InChIKey | AWAMUMFWBMCOSK-WUKNDPDISA-N |
| XLogP | 4.33 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|