C28H37N5O — CID 136649512
8-amino-3,6-dimethyl-2,7-bis(methyldiazenyl)naphthalen-1-ol;ethane;naphthalene (PubChem CID 136649512) has the molecular formula C28H37N5O and a molecular weight of 459.64 g/mol. Its IUPAC name is 8-amino-3,6-dimethyl-2,7-bis(methyldiazenyl)naphthalen-1-ol;ethane;naphthalene.
| Compound Name | 8-amino-3,6-dimethyl-2,7-bis(methyldiazenyl)naphthalen-1-ol;ethane;naphthalene |
|---|---|
| PubChem CID | 136649512 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | 8-amino-3,6-dimethyl-2,7-bis(methyldiazenyl)naphthalen-1-ol;ethane;naphthalene |
| SMILES | C/N=N/c1c(C)cc2cc(C)c(/N=N/C)c(O)c2c1N.CC.CC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H17N5O.C10H8.2C2H6/c1-7-5-9-6-8(2)13(19-17-4)14(20)10(9)11(15)12(7)18-16-3;1-2-6-10-8-4-3-7-9(10)5-1;2*1-2/h5-6,20H,15H2,1-4H3;1-8H;2*1-2H3/b18-16+,19-17+;;; |
| InChIKey | BDGMEWIIOVASLW-ACCFFOGNSA-N |
| XLogP | 9.06 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|