C35H30N6O4 — CID 136613538
4-[[1-amino-7-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-2-yl]diazenyl]benzonitrile (PubChem CID 136613538) has the molecular formula C35H30N6O4 and a molecular weight of 598.66 g/mol. Its IUPAC name is 4-[[1-amino-7-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-2-yl]diazenyl]benzonitrile.
| Compound Name | 4-[[1-amino-7-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-2-yl]diazenyl]benzonitrile |
|---|---|
| PubChem CID | 136613538 |
| Molecular Formula | C35H30N6O4 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 4-[[1-amino-7-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-8-hydroxy-3,6-dimethylnaphthalen-2-yl]diazenyl]benzonitrile |
| SMILES | COC(OC)(C(=O)c1ccc(/N=N/c2c(C)cc3cc(C)c(/N=N/c4ccc(C#N)cc4)c(N)c3c2O)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H30N6O4/c1-21-18-25-19-22(2)32(33(42)29(25)30(37)31(21)40-38-27-14-10-23(20-36)11-15-27)41-39-28-16-12-24(13-17-28)34(43)35(44-3,45-4)26-8-6-5-7-9-26/h5-19,42H,37H2,1-4H3/b40-38+,41-39+ |
| InChIKey | AEYZXGQHHLVSKH-QYGUTFKISA-N |
| XLogP | 8.78 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|