C33H26N6O10S2 — CID 136629003
4-amino-3-[(4-cyanophenyl)diazenyl]-6-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136629003) has the molecular formula C33H26N6O10S2 and a molecular weight of 730.74 g/mol. Its IUPAC name is 4-amino-3-[(4-cyanophenyl)diazenyl]-6-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[(4-cyanophenyl)diazenyl]-6-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136629003 |
| Molecular Formula | C33H26N6O10S2 |
| Molecular Weight | 730.74 g/mol |
| Exact Mass | 730.12 |
| IUPAC Name | 4-amino-3-[(4-cyanophenyl)diazenyl]-6-[[4-(2,2-dimethoxy-2-phenylacetyl)phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | COC(OC)(C(=O)c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(C#N)cc4)c(N)c3c2O)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H26N6O10S2/c1-48-33(49-2,22-6-4-3-5-7-22)32(41)20-10-14-24(15-11-20)37-39-30-26(51(45,46)47)17-21-16-25(50(42,43)44)29(28(35)27(21)31(30)40)38-36-23-12-8-19(18-34)9-13-23/h3-17,40H,35H2,1-2H3,(H,42,43,44)(H,45,46,47)/b38-36+,39-37+ |
| InChIKey | QBGUYRVQPNKQBU-NFSGFYSESA-N |
| XLogP | 6.65 |
| TPSA | 263.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|