C24H21N5O — CID 135733615
8-amino-3,6-dimethyl-2,7-bis(phenyldiazenyl)naphthalen-1-ol (PubChem CID 135733615) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 8-amino-3,6-dimethyl-2,7-bis(phenyldiazenyl)naphthalen-1-ol.
| Compound Name | 8-amino-3,6-dimethyl-2,7-bis(phenyldiazenyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 135733615 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 8-amino-3,6-dimethyl-2,7-bis(phenyldiazenyl)naphthalen-1-ol |
| SMILES | Cc1cc2cc(C)c(/N=N/c3ccccc3)c(O)c2c(N)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C24H21N5O/c1-15-13-17-14-16(2)23(29-27-19-11-7-4-8-12-19)24(30)20(17)21(25)22(15)28-26-18-9-5-3-6-10-18/h3-14,30H,25H2,1-2H3/b28-26+,29-27+ |
| InChIKey | GKMVAUIYVZSDQD-TUUFZWAFSA-N |
| XLogP | 7.58 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|