C18H17N3O — CID 135714413
8-amino-3,6-dimethyl-2-phenyldiazenylnaphthalen-1-ol (PubChem CID 135714413) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 8-amino-3,6-dimethyl-2-phenyldiazenylnaphthalen-1-ol.
| Compound Name | 8-amino-3,6-dimethyl-2-phenyldiazenylnaphthalen-1-ol |
|---|---|
| PubChem CID | 135714413 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 8-amino-3,6-dimethyl-2-phenyldiazenylnaphthalen-1-ol |
| SMILES | Cc1cc(N)c2c(O)c(/N=N/c3ccccc3)c(C)cc2c1 |
| InChI | InChI=1S/C18H17N3O/c1-11-8-13-10-12(2)17(18(22)16(13)15(19)9-11)21-20-14-6-4-3-5-7-14/h3-10,22H,19H2,1-2H3/b21-20+ |
| InChIKey | CNCREOGOYJDOCA-QZQOTICOSA-N |
| XLogP | 5.16 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|